C17H33N2O4P — CID 141315633
[(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-(diethylamino)cyclohexen-1-yl]phosphonic acid (PubChem CID 141315633) has the molecular formula C17H33N2O4P and a molecular weight of 360.44 g/mol. Its IUPAC name is [(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-(diethylamino)cyclohexen-1-yl]phosphonic acid.
| Compound Name | [(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-(diethylamino)cyclohexen-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 141315633 |
| Molecular Formula | C17H33N2O4P |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | [(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-(diethylamino)cyclohexen-1-yl]phosphonic acid |
| SMILES | CCN(CC)[C@@H]1CC(P(=O)(O)O)=CC[C@@H]1[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C17H33N2O4P/c1-6-19(7-2)17-11-14(24(21,22)23)8-9-15(17)16(10-12(3)4)18-13(5)20/h8,12,15-17H,6-7,9-11H2,1-5H3,(H,18,20)(H2,21,22,23)/t15-,16+,17-/m1/s1 |
| InChIKey | PNDVMFWQPAYNRP-IXDOHACOSA-N |
| XLogP | 2.72 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|