C13H25N4O4P — CID 141315645
[(4R,5S)-4-[(1S)-1-acetamidobutyl]-5-(diaminomethylideneamino)cyclohexen-1-yl]phosphonic acid (PubChem CID 141315645) has the molecular formula C13H25N4O4P and a molecular weight of 332.34 g/mol. Its IUPAC name is [(4R,5S)-4-[(1S)-1-acetamidobutyl]-5-(diaminomethylideneamino)cyclohexen-1-yl]phosphonic acid.
| Compound Name | [(4R,5S)-4-[(1S)-1-acetamidobutyl]-5-(diaminomethylideneamino)cyclohexen-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 141315645 |
| Molecular Formula | C13H25N4O4P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [(4R,5S)-4-[(1S)-1-acetamidobutyl]-5-(diaminomethylideneamino)cyclohexen-1-yl]phosphonic acid |
| SMILES | CCC[C@H](NC(C)=O)[C@H]1CC=C(P(=O)(O)O)C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C13H25N4O4P/c1-3-4-11(16-8(2)18)10-6-5-9(22(19,20)21)7-12(10)17-13(14)15/h5,10-12H,3-4,6-7H2,1-2H3,(H,16,18)(H4,14,15,17)(H2,19,20,21)/t10-,11+,12+/m1/s1 |
| InChIKey | QKBWSHLWZGSXOV-WOPDTQHZSA-N |
| XLogP | 0.40 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|