C13H24NO4PS — CID 141315701
[(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-sulfanylcyclohexen-1-yl]phosphonic acid (PubChem CID 141315701) has the molecular formula C13H24NO4PS and a molecular weight of 321.38 g/mol. Its IUPAC name is [(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-sulfanylcyclohexen-1-yl]phosphonic acid.
| Compound Name | [(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-sulfanylcyclohexen-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 141315701 |
| Molecular Formula | C13H24NO4PS |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [(4R,5R)-4-[(1S)-1-acetamido-3-methylbutyl]-5-sulfanylcyclohexen-1-yl]phosphonic acid |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@H]1CC=C(P(=O)(O)O)C[C@H]1S |
| InChI | InChI=1S/C13H24NO4PS/c1-8(2)6-12(14-9(3)15)11-5-4-10(7-13(11)20)19(16,17)18/h4,8,11-13,20H,5-7H2,1-3H3,(H,14,15)(H2,16,17,18)/t11-,12+,13-/m1/s1 |
| InChIKey | IDQPEROUZOEGJS-FRRDWIJNSA-N |
| XLogP | 2.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|