C15H10Cl2F2N2 — CID 141315860
3-[1-(2,6-dichloro-3-fluorophenyl)-2-fluoroethyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 141315860) has the molecular formula C15H10Cl2F2N2 and a molecular weight of 327.16 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)-2-fluoroethyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)-2-fluoroethyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 141315860 |
| Molecular Formula | C15H10Cl2F2N2 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)-2-fluoroethyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | FCC(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C15H10Cl2F2N2/c16-11-3-4-12(19)14(17)13(11)9(6-18)10-7-21-15-8(10)2-1-5-20-15/h1-5,7,9H,6H2,(H,20,21) |
| InChIKey | IUKNNVNALXSCJZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|