About imidazo[1,2-c]pyrimidine-7-carbohydrazide
imidazo[1,2-c]pyrimidine-7-carbohydrazide (PubChem CID 141316614) has the molecular formula C7H7N5O
and a molecular weight of 177.17 g/mol. Its IUPAC name is imidazo[1,2-c]pyrimidine-7-carbohydrazide.
Molecular Properties
| Compound Name | imidazo[1,2-c]pyrimidine-7-carbohydrazide |
| PubChem CID | 141316614 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | imidazo[1,2-c]pyrimidine-7-carbohydrazide |
| SMILES | NNC(=O)c1cc2nccn2cn1 |
| InChI | InChI=1S/C7H7N5O/c8-11-7(13)5-3-6-9-1-2-12(6)4-10-5/h1-4H,8H2,(H,11,13) |
| InChIKey | FVJSNAIHARHOLT-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze imidazo[1,2-c]pyrimidine-7-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-c]pyrimidine-7-carbohydrazide?
The IUPAC name of imidazo[1,2-c]pyrimidine-7-carbohydrazide (CID 141316614) is imidazo[1,2-c]pyrimidine-7-carbohydrazide.
What is the SMILES notation for imidazo[1,2-c]pyrimidine-7-carbohydrazide?
The canonical SMILES for imidazo[1,2-c]pyrimidine-7-carbohydrazide is NNC(=O)c1cc2nccn2cn1.
What is the InChIKey of imidazo[1,2-c]pyrimidine-7-carbohydrazide?
The InChIKey is FVJSNAIHARHOLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O/c8-11-7(13)5-3-6-9-1-2-12(6)4-10-5/h1-4H,8H2,(H,11,13).
What are the key properties of imidazo[1,2-c]pyrimidine-7-carbohydrazide?
imidazo[1,2-c]pyrimidine-7-carbohydrazide has a molecular weight of 177.17 g/mol, XLogP of -0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-c]pyrimidine-7-carbohydrazide is sourced from PubChem (CID 141316614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).