C30H30FN3O6S2 — CID 141316781
1-[5-[1-(3-fluoro-1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol (PubChem CID 141316781) has the molecular formula C30H30FN3O6S2 and a molecular weight of 611.72 g/mol. Its IUPAC name is 1-[5-[1-(3-fluoro-1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol.
| Compound Name | 1-[5-[1-(3-fluoro-1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 141316781 |
| Molecular Formula | C30H30FN3O6S2 |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | 1-[5-[1-(3-fluoro-1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
| SMILES | COc1cc(-c2cc3c(-c4cnc(C5(O)CCC5)s4)ccnc3n2S(=O)(=O)C2(C)C=C(F)C=CC2)cc(OC)c1OC |
| InChI | InChI=1S/C30H30FN3O6S2/c1-29(9-5-7-19(31)16-29)42(36,37)34-22(18-13-23(38-2)26(40-4)24(14-18)39-3)15-21-20(8-12-32-27(21)34)25-17-33-28(41-25)30(35)10-6-11-30/h5,7-8,12-17,35H,6,9-11H2,1-4H3 |
| InChIKey | YFAHHZFIORDEBI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |