About cesium hexane-1-sulfonate
cesium hexane-1-sulfonate (PubChem CID 141317548) has the molecular formula C6H13CsO3S
and a molecular weight of 298.14 g/mol. Its IUPAC name is cesium hexane-1-sulfonate.
Molecular Properties
| Compound Name | cesium hexane-1-sulfonate |
| PubChem CID | 141317548 |
| Molecular Formula | C6H13CsO3S |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | cesium hexane-1-sulfonate |
| SMILES | CCCCCCS(=O)(=O)[O-].[Cs+] |
| InChI | InChI=1S/C6H14O3S.Cs/c1-2-3-4-5-6-10(7,8)9;/h2-6H2,1H3,(H,7,8,9);/q;+1/p-1 |
| InChIKey | FSPXGXNMONHKRG-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cesium hexane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium hexane-1-sulfonate?
The IUPAC name of cesium hexane-1-sulfonate (CID 141317548) is cesium hexane-1-sulfonate.
What is the SMILES notation for cesium hexane-1-sulfonate?
The canonical SMILES for cesium hexane-1-sulfonate is CCCCCCS(=O)(=O)[O-].[Cs+].
What is the InChIKey of cesium hexane-1-sulfonate?
The InChIKey is FSPXGXNMONHKRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14O3S.Cs/c1-2-3-4-5-6-10(7,8)9;/h2-6H2,1H3,(H,7,8,9);/q;+1/p-1.
What are the key properties of cesium hexane-1-sulfonate?
cesium hexane-1-sulfonate has a molecular weight of 298.14 g/mol, XLogP of -1.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium hexane-1-sulfonate is sourced from PubChem (CID 141317548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).