About 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one
7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 141317765) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
Analyze 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one?
The IUPAC name of 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (CID 141317765) is 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
What is the SMILES notation for 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one?
The canonical SMILES for 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one is COC1CCC2=C(C1)C(=O)CCC2.
What is the InChIKey of 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one?
The InChIKey is YXNDBCKNHRNCKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h9H,2-7H2,1H3.
What are the key properties of 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one?
7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one has a molecular weight of 180.25 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one is sourced from PubChem (CID 141317765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).