About 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol
2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol (PubChem CID 141317965) has the molecular formula C25H26N4O2
and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol.
Molecular Properties
| Compound Name | 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol |
| PubChem CID | 141317965 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol |
| SMILES | Cc1cccc(C)c1Oc1c(N2CCNCC2)c2ncc(O)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H26N4O2/c1-17-7-6-8-18(2)24(17)31-25-23(28-13-11-26-12-14-28)22-21(15-20(30)16-27-22)29(25)19-9-4-3-5-10-19/h3-10,15-16,26,30H,11-14H2,1-2H3 |
| InChIKey | DKNQKSIYJSFJEW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol?
The IUPAC name of 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol (CID 141317965) is 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol.
What is the SMILES notation for 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol?
The canonical SMILES for 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol is Cc1cccc(C)c1Oc1c(N2CCNCC2)c2ncc(O)cc2n1-c1ccccc1.
What is the InChIKey of 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol?
The InChIKey is DKNQKSIYJSFJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N4O2/c1-17-7-6-8-18(2)24(17)31-25-23(28-13-11-26-12-14-28)22-21(15-20(30)16-27-22)29(25)19-9-4-3-5-10-19/h3-10,15-16,26,30H,11-14H2,1-2H3.
What are the key properties of 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol?
2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol has a molecular weight of 414.51 g/mol, XLogP of 4.55, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylphenoxy)-1-phenyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridin-6-ol is sourced from PubChem (CID 141317965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).