C11H14O2 — CID 141318141
7-methoxy-4-methyl-2,3,4,5-tetrahydroinden-1-one (PubChem CID 141318141) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-methoxy-4-methyl-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 7-methoxy-4-methyl-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141318141 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 7-methoxy-4-methyl-2,3,4,5-tetrahydroinden-1-one |
| SMILES | COC1=CCC(C)C2=C1C(=O)CC2 |
| InChI | InChI=1S/C11H14O2/c1-7-3-6-10(13-2)11-8(7)4-5-9(11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | OEOMAICMWMYIRJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |