About 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline
5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline (PubChem CID 141318171) has the molecular formula C17H15FN4
and a molecular weight of 294.33 g/mol. Its IUPAC name is 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline |
| PubChem CID | 141318171 |
| Molecular Formula | C17H15FN4 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline |
| SMILES | CCN1Cc2cn[nH]c2-c2ccc(-c3cccnc3F)cc21 |
| InChI | InChI=1S/C17H15FN4/c1-2-22-10-12-9-20-21-16(12)14-6-5-11(8-15(14)22)13-4-3-7-19-17(13)18/h3-9H,2,10H2,1H3,(H,20,21) |
| InChIKey | WQPJGPRNHMRCFE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline?
The IUPAC name of 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline (CID 141318171) is 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline.
What is the SMILES notation for 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline?
The canonical SMILES for 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline is CCN1Cc2cn[nH]c2-c2ccc(-c3cccnc3F)cc21.
What is the InChIKey of 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline?
The InChIKey is WQPJGPRNHMRCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN4/c1-2-22-10-12-9-20-21-16(12)14-6-5-11(8-15(14)22)13-4-3-7-19-17(13)18/h3-9H,2,10H2,1H3,(H,20,21).
What are the key properties of 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline?
5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline has a molecular weight of 294.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7-(2-fluoro-3-pyridinyl)-1,4-dihydropyrazolo[4,5-c]quinoline is sourced from PubChem (CID 141318171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).