C12H14O6 — CID 141318348
1-(1,6-dihydroxycyclohexa-2,4-dien-1-yl)peroxycyclohexa-3,5-diene-1,2-diol (PubChem CID 141318348) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 1-(1,6-dihydroxycyclohexa-2,4-dien-1-yl)peroxycyclohexa-3,5-diene-1,2-diol.
| Compound Name | 1-(1,6-dihydroxycyclohexa-2,4-dien-1-yl)peroxycyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 141318348 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-(1,6-dihydroxycyclohexa-2,4-dien-1-yl)peroxycyclohexa-3,5-diene-1,2-diol |
| SMILES | OC1C=CC=CC1(O)OOC1(O)C=CC=CC1O |
| InChI | InChI=1S/C12H14O6/c13-9-5-1-3-7-11(9,15)17-18-12(16)8-4-2-6-10(12)14/h1-10,13-16H |
| InChIKey | LHWLWEGGCVUNAZ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|