C19H30O3 — CID 141318491
2-[4-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl]prop-2-enoic acid (PubChem CID 141318491) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[4-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl]prop-2-enoic acid.
| Compound Name | 2-[4-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141318491 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-[4-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC([C@]2(O)C[C@H]3CC[C@]2(C)C3(C)C)CC1 |
| InChI | InChI=1S/C19H30O3/c1-12(16(20)21)13-5-7-14(8-6-13)19(22)11-15-9-10-18(19,4)17(15,2)3/h13-15,22H,1,5-11H2,2-4H3,(H,20,21)/t13?,14?,15-,18-,19-/m1/s1 |
| InChIKey | KQNJOTMUGXDZRL-XMMNMGKXSA-N |
| XLogP | 4.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|