C28H22F3N3O2 — CID 141318675
4-[4-[3-[4-phenyl-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]butanoic acid (PubChem CID 141318675) has the molecular formula C28H22F3N3O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 4-[4-[3-[4-phenyl-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]butanoic acid.
| Compound Name | 4-[4-[3-[4-phenyl-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 141318675 |
| Molecular Formula | C28H22F3N3O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 4-[4-[3-[4-phenyl-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1ccc2c(-c3cc(-c4ccc(-c5ccccc5)c(C(F)(F)F)c4)n[nH]3)cccc21 |
| InChI | InChI=1S/C28H22F3N3O2/c29-28(30,31)23-16-19(11-12-20(23)18-6-2-1-3-7-18)24-17-25(33-32-24)21-8-4-9-26-22(21)13-15-34(26)14-5-10-27(35)36/h1-4,6-9,11-13,15-17H,5,10,14H2,(H,32,33)(H,35,36) |
| InChIKey | CPGZHGKTNNYSOF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |