C38H49FO10Si — CID 141319521
[(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[4-fluoro-3-[1-phenyl-3-tri(propan-2-yl)silylprop-2-ynyl]phenyl]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141319521) has the molecular formula C38H49FO10Si and a molecular weight of 716.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[4-fluoro-3-[1-phenyl-3-tri(propan-2-yl)silylprop-2-ynyl]phenyl]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[4-fluoro-3-[1-phenyl-3-tri(propan-2-yl)silylprop-2-ynyl]phenyl]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141319521 |
| Molecular Formula | C38H49FO10Si |
| Molecular Weight | 716.91 g/mol |
| Exact Mass | 716.33 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[4-fluoro-3-[1-phenyl-3-tri(propan-2-yl)silylprop-2-ynyl]phenyl]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(O)(c2ccc(F)c(C(C#C[Si](C(C)C)(C(C)C)C(C)C)c3ccccc3)c2)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C38H49FO10Si/c1-22(2)50(23(3)4,24(5)6)19-18-31(29-14-12-11-13-15-29)32-20-30(16-17-33(32)39)38(44)37(48-28(10)43)36(47-27(9)42)35(46-26(8)41)34(49-38)21-45-25(7)40/h11-17,20,22-24,31,34-37,44H,21H2,1-10H3/t31?,34-,35-,36+,37-,38?/m1/s1/i7D,8D,9D,10D |
| InChIKey | IYFSZXFYKKYKMU-BSFILITHSA-N |
| XLogP | 6.08 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.91 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|