C28H43ClO8 — CID 141320189
tetrakis(2-methylpropyl) 7-chlorobicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate (PubChem CID 141320189) has the molecular formula C28H43ClO8 and a molecular weight of 543.10 g/mol. Its IUPAC name is tetrakis(2-methylpropyl) 7-chlorobicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate.
| Compound Name | tetrakis(2-methylpropyl) 7-chlorobicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 141320189 |
| Molecular Formula | C28H43ClO8 |
| Molecular Weight | 543.10 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | tetrakis(2-methylpropyl) 7-chlorobicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate |
| SMILES | CC(C)COC(=O)C1C2C=C(Cl)C(C1C(=O)OCC(C)C)C(C(=O)OCC(C)C)C2C(=O)OCC(C)C |
| InChI | InChI=1S/C28H43ClO8/c1-14(2)10-34-25(30)20-18-9-19(29)22(23(20)27(32)36-12-16(5)6)24(28(33)37-13-17(7)8)21(18)26(31)35-11-15(3)4/h9,14-18,20-24H,10-13H2,1-8H3 |
| InChIKey | HMTHDHLXBVZXIW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|