C22H25NO3 — CID 141320363
4-but-3-enyl-5-ethyl-2,2-diphenyl-1,3-oxazolidine-4-carboxylic acid (PubChem CID 141320363) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-but-3-enyl-5-ethyl-2,2-diphenyl-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | 4-but-3-enyl-5-ethyl-2,2-diphenyl-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 141320363 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-but-3-enyl-5-ethyl-2,2-diphenyl-1,3-oxazolidine-4-carboxylic acid |
| SMILES | C=CCCC1(C(=O)O)NC(c2ccccc2)(c2ccccc2)OC1CC |
| InChI | InChI=1S/C22H25NO3/c1-3-5-16-21(20(24)25)19(4-2)26-22(23-21,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h3,6-15,19,23H,1,4-5,16H2,2H3,(H,24,25) |
| InChIKey | PXYYZTWWQDWKIY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|