About 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine
3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine (PubChem CID 141320420) has the molecular formula C18H10ClF3N4
and a molecular weight of 374.75 g/mol. Its IUPAC name is 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine |
| PubChem CID | 141320420 |
| Molecular Formula | C18H10ClF3N4 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine |
| SMILES | Fc1cccc(-c2ccc3nnn(Cc4c(F)ccc(F)c4Cl)c3n2)c1 |
| InChI | InChI=1S/C18H10ClF3N4/c19-17-12(13(21)4-5-14(17)22)9-26-18-16(24-25-26)7-6-15(23-18)10-2-1-3-11(20)8-10/h1-8H,9H2 |
| InChIKey | WQUZUJXQGHLAQE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine?
The IUPAC name of 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine (CID 141320420) is 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine.
What is the SMILES notation for 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine?
The canonical SMILES for 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine is Fc1cccc(-c2ccc3nnn(Cc4c(F)ccc(F)c4Cl)c3n2)c1.
What is the InChIKey of 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine?
The InChIKey is WQUZUJXQGHLAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10ClF3N4/c19-17-12(13(21)4-5-14(17)22)9-26-18-16(24-25-26)7-6-15(23-18)10-2-1-3-11(20)8-10/h1-8H,9H2.
What are the key properties of 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine?
3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine has a molecular weight of 374.75 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-3,6-difluorophenyl)methyl]-5-(3-fluorophenyl)triazolo[4,5-b]pyridine is sourced from PubChem (CID 141320420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).