C18H18ClNO4 — CID 141320574
(2Z)-4-(2-chloroanilino)-4-hydroxy-2-[(4-methoxyphenyl)methylidene]butanoic acid (PubChem CID 141320574) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is (2Z)-4-(2-chloroanilino)-4-hydroxy-2-[(4-methoxyphenyl)methylidene]butanoic acid.
| Compound Name | (2Z)-4-(2-chloroanilino)-4-hydroxy-2-[(4-methoxyphenyl)methylidene]butanoic acid |
|---|---|
| PubChem CID | 141320574 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (2Z)-4-(2-chloroanilino)-4-hydroxy-2-[(4-methoxyphenyl)methylidene]butanoic acid |
| SMILES | COc1ccc(/C=C(/CC(O)Nc2ccccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C18H18ClNO4/c1-24-14-8-6-12(7-9-14)10-13(18(22)23)11-17(21)20-16-5-3-2-4-15(16)19/h2-10,17,20-21H,11H2,1H3,(H,22,23)/b13-10- |
| InChIKey | OCHZVOUHXCQENF-RAXLEYEMSA-N |
| XLogP | 3.64 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|