C15H13F4N3O3 — CID 141320643
[3-fluoro-5-[4-methoxy-2-(trifluoromethyl)anilino]-2-pyridinyl]methylcarbamic acid (PubChem CID 141320643) has the molecular formula C15H13F4N3O3 and a molecular weight of 359.28 g/mol. Its IUPAC name is [3-fluoro-5-[4-methoxy-2-(trifluoromethyl)anilino]-2-pyridinyl]methylcarbamic acid.
| Compound Name | [3-fluoro-5-[4-methoxy-2-(trifluoromethyl)anilino]-2-pyridinyl]methylcarbamic acid |
|---|---|
| PubChem CID | 141320643 |
| Molecular Formula | C15H13F4N3O3 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | [3-fluoro-5-[4-methoxy-2-(trifluoromethyl)anilino]-2-pyridinyl]methylcarbamic acid |
| SMILES | COc1ccc(Nc2cnc(CNC(=O)O)c(F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F4N3O3/c1-25-9-2-3-12(10(5-9)15(17,18)19)22-8-4-11(16)13(20-6-8)7-21-14(23)24/h2-6,21-22H,7H2,1H3,(H,23,24) |
| InChIKey | IOGPATAAMCBKGQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |