C6H7ClF2O3 — CID 141320670
1-chloroethyl 4,4-difluoro-3-oxobutanoate (PubChem CID 141320670) has the molecular formula C6H7ClF2O3 and a molecular weight of 200.57 g/mol. Its IUPAC name is 1-chloroethyl 4,4-difluoro-3-oxobutanoate.
| Compound Name | 1-chloroethyl 4,4-difluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 141320670 |
| Molecular Formula | C6H7ClF2O3 |
| Molecular Weight | 200.57 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 1-chloroethyl 4,4-difluoro-3-oxobutanoate |
| SMILES | CC(Cl)OC(=O)CC(=O)C(F)F |
| InChI | InChI=1S/C6H7ClF2O3/c1-3(7)12-5(11)2-4(10)6(8)9/h3,6H,2H2,1H3 |
| InChIKey | XZXLOZGFAMFUCL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|