About 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate
6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate (PubChem CID 141320711) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate.
Molecular Properties
| Compound Name | 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate |
| PubChem CID | 141320711 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC=C1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C14H19NO4/c1-3-13(17)19-9-7-5-4-6-8-11-10-12(16)15(2)14(11)18/h3,8H,1,4-7,9-10H2,2H3 |
| InChIKey | BPWAAJMWTXHPAY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate?
The IUPAC name of 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate (CID 141320711) is 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate.
What is the SMILES notation for 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate?
The canonical SMILES for 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate is C=CC(=O)OCCCCCC=C1CC(=O)N(C)C1=O.
What is the InChIKey of 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate?
The InChIKey is BPWAAJMWTXHPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-3-13(17)19-9-7-5-4-6-8-11-10-12(16)15(2)14(11)18/h3,8H,1,4-7,9-10H2,2H3.
What are the key properties of 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate?
6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate has a molecular weight of 265.31 g/mol, XLogP of 1.59, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-methyl-2,5-dioxopyrrolidin-3-ylidene)hexyl prop-2-enoate is sourced from PubChem (CID 141320711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).