About 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol
2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol (PubChem CID 141321126) has the molecular formula C12H15FN2O5
and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol.
Molecular Properties
| Compound Name | 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol |
| PubChem CID | 141321126 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol |
| SMILES | CC1(F)OC(c2ccncc2[N+](=O)[O-])CC(O)C1(C)O |
| InChI | InChI=1S/C12H15FN2O5/c1-11(17)10(16)5-9(20-12(11,2)13)7-3-4-14-6-8(7)15(18)19/h3-4,6,9-10,16-17H,5H2,1-2H3 |
| InChIKey | FYLVWYJVKWASPE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol?
The IUPAC name of 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol (CID 141321126) is 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol.
What is the SMILES notation for 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol?
The canonical SMILES for 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol is CC1(F)OC(c2ccncc2[N+](=O)[O-])CC(O)C1(C)O.
What is the InChIKey of 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol?
The InChIKey is FYLVWYJVKWASPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN2O5/c1-11(17)10(16)5-9(20-12(11,2)13)7-3-4-14-6-8(7)15(18)19/h3-4,6,9-10,16-17H,5H2,1-2H3.
What are the key properties of 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol?
2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol has a molecular weight of 286.26 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol is sourced from PubChem (CID 141321126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).