About 2-methylbutyl 2-iminohexanoate
2-methylbutyl 2-iminohexanoate (PubChem CID 141321390) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-methylbutyl 2-iminohexanoate.
Molecular Properties
| Compound Name | 2-methylbutyl 2-iminohexanoate |
| PubChem CID | 141321390 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-methylbutyl 2-iminohexanoate |
| SMILES | [H]/N=C(\CCCC)C(=O)OCC(C)CC |
| InChI | InChI=1S/C11H21NO2/c1-4-6-7-10(12)11(13)14-8-9(3)5-2/h9,12H,4-8H2,1-3H3/b12-10+ |
| InChIKey | FSLJZDXKLCQEBD-ZRDIBKRKSA-N |
| XLogP | 2.79 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl 2-iminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 2-iminohexanoate?
The IUPAC name of 2-methylbutyl 2-iminohexanoate (CID 141321390) is 2-methylbutyl 2-iminohexanoate.
What is the SMILES notation for 2-methylbutyl 2-iminohexanoate?
The canonical SMILES for 2-methylbutyl 2-iminohexanoate is [H]/N=C(\CCCC)C(=O)OCC(C)CC.
What is the InChIKey of 2-methylbutyl 2-iminohexanoate?
The InChIKey is FSLJZDXKLCQEBD-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H21NO2/c1-4-6-7-10(12)11(13)14-8-9(3)5-2/h9,12H,4-8H2,1-3H3/b12-10+.
What are the key properties of 2-methylbutyl 2-iminohexanoate?
2-methylbutyl 2-iminohexanoate has a molecular weight of 199.29 g/mol, XLogP of 2.79, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 2-iminohexanoate is sourced from PubChem (CID 141321390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).