C30H28Cl2O7Se — CID 141321860
5-[5-chloro-2-[4-chloro-2-(3,4,5-trimethoxyphenyl)phenyl]seleninylphenyl]-1,2,3-trimethoxybenzene (PubChem CID 141321860) has the molecular formula C30H28Cl2O7Se and a molecular weight of 650.41 g/mol. Its IUPAC name is 5-[5-chloro-2-[4-chloro-2-(3,4,5-trimethoxyphenyl)phenyl]seleninylphenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[5-chloro-2-[4-chloro-2-(3,4,5-trimethoxyphenyl)phenyl]seleninylphenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 141321860 |
| Molecular Formula | C30H28Cl2O7Se |
| Molecular Weight | 650.41 g/mol |
| Exact Mass | 650.04 |
| IUPAC Name | 5-[5-chloro-2-[4-chloro-2-(3,4,5-trimethoxyphenyl)phenyl]seleninylphenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(-c2cc(Cl)ccc2[Se](=O)c2ccc(Cl)cc2-c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H28Cl2O7Se/c1-34-23-11-17(12-24(35-2)29(23)38-5)21-15-19(31)7-9-27(21)40(33)28-10-8-20(32)16-22(28)18-13-25(36-3)30(39-6)26(14-18)37-4/h7-16H,1-6H3 |
| InChIKey | GKJKXIFLMVEXAN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|