About 6-fluoro-1H-phenanthro[9,10-d]pyrazole
6-fluoro-1H-phenanthro[9,10-d]pyrazole (PubChem CID 141323090) has the molecular formula C15H9FN2
and a molecular weight of 236.25 g/mol. Its IUPAC name is 6-fluoro-1H-phenanthro[9,10-d]pyrazole.
Molecular Properties
| Compound Name | 6-fluoro-1H-phenanthro[9,10-d]pyrazole |
| PubChem CID | 141323090 |
| Molecular Formula | C15H9FN2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 6-fluoro-1H-phenanthro[9,10-d]pyrazole |
| SMILES | Fc1ccc2c(c1)c1ccccc1c1[nH]ncc21 |
| InChI | InChI=1S/C15H9FN2/c16-9-5-6-11-13(7-9)10-3-1-2-4-12(10)15-14(11)8-17-18-15/h1-8H,(H,17,18) |
| InChIKey | WVCKNNXCYQVKLF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1H-phenanthro[9,10-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1H-phenanthro[9,10-d]pyrazole?
The IUPAC name of 6-fluoro-1H-phenanthro[9,10-d]pyrazole (CID 141323090) is 6-fluoro-1H-phenanthro[9,10-d]pyrazole.
What is the SMILES notation for 6-fluoro-1H-phenanthro[9,10-d]pyrazole?
The canonical SMILES for 6-fluoro-1H-phenanthro[9,10-d]pyrazole is Fc1ccc2c(c1)c1ccccc1c1[nH]ncc21.
What is the InChIKey of 6-fluoro-1H-phenanthro[9,10-d]pyrazole?
The InChIKey is WVCKNNXCYQVKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN2/c16-9-5-6-11-13(7-9)10-3-1-2-4-12(10)15-14(11)8-17-18-15/h1-8H,(H,17,18).
What are the key properties of 6-fluoro-1H-phenanthro[9,10-d]pyrazole?
6-fluoro-1H-phenanthro[9,10-d]pyrazole has a molecular weight of 236.25 g/mol, XLogP of 4.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1H-phenanthro[9,10-d]pyrazole is sourced from PubChem (CID 141323090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).