C22H27F3N4 — CID 141323120
(1S,8R)-1,11,11-trimethyl-5-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undecane (PubChem CID 141323120) has the molecular formula C22H27F3N4 and a molecular weight of 404.48 g/mol. Its IUPAC name is (1S,8R)-1,11,11-trimethyl-5-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undecane.
| Compound Name | (1S,8R)-1,11,11-trimethyl-5-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 141323120 |
| Molecular Formula | C22H27F3N4 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1S,8R)-1,11,11-trimethyl-5-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undecane |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C1NNC(c3cnn(-c4ccccc4)c3C(F)(F)F)CC12 |
| InChI | InChI=1S/C22H27F3N4/c1-20(2)16-9-10-21(20,3)18-14(16)11-17(27-28-18)15-12-26-29(19(15)22(23,24)25)13-7-5-4-6-8-13/h4-8,12,14,16-18,27-28H,9-11H2,1-3H3/t14?,16-,17?,18?,21-/m1/s1 |
| InChIKey | JNSMBAAKUXQDLH-BKZGCPOMSA-N |
| XLogP | 4.87 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |