C22H26ClN5 — CID 141323468
1-[5-[5-[4-(chloromethyl)phenyl]-1H-pyrazol-3-yl]-2-pyridinyl]-4-propan-2-ylpiperazine (PubChem CID 141323468) has the molecular formula C22H26ClN5 and a molecular weight of 395.94 g/mol. Its IUPAC name is 1-[5-[5-[4-(chloromethyl)phenyl]-1H-pyrazol-3-yl]-2-pyridinyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[5-[5-[4-(chloromethyl)phenyl]-1H-pyrazol-3-yl]-2-pyridinyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 141323468 |
| Molecular Formula | C22H26ClN5 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[5-[5-[4-(chloromethyl)phenyl]-1H-pyrazol-3-yl]-2-pyridinyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(c2ccc(-c3cc(-c4ccc(CCl)cc4)[nH]n3)cn2)CC1 |
| InChI | InChI=1S/C22H26ClN5/c1-16(2)27-9-11-28(12-10-27)22-8-7-19(15-24-22)21-13-20(25-26-21)18-5-3-17(14-23)4-6-18/h3-8,13,15-16H,9-12,14H2,1-2H3,(H,25,26) |
| InChIKey | MWCHGSRRYHDHES-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|