About N-but-2-enyl-2,3-dihydroxypropanamide;hydrate
N-but-2-enyl-2,3-dihydroxypropanamide;hydrate (PubChem CID 141324143) has the molecular formula C7H15NO4
and a molecular weight of 177.20 g/mol. Its IUPAC name is N-but-2-enyl-2,3-dihydroxypropanamide;hydrate.
Molecular Properties
| Compound Name | N-but-2-enyl-2,3-dihydroxypropanamide;hydrate |
| PubChem CID | 141324143 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-but-2-enyl-2,3-dihydroxypropanamide;hydrate |
| SMILES | CC=CCNC(=O)C(O)CO.O |
| InChI | InChI=1S/C7H13NO3.H2O/c1-2-3-4-8-7(11)6(10)5-9;/h2-3,6,9-10H,4-5H2,1H3,(H,8,11);1H2 |
| InChIKey | IEDWUVBDQOHLMS-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-enyl-2,3-dihydroxypropanamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-enyl-2,3-dihydroxypropanamide;hydrate?
The IUPAC name of N-but-2-enyl-2,3-dihydroxypropanamide;hydrate (CID 141324143) is N-but-2-enyl-2,3-dihydroxypropanamide;hydrate.
What is the SMILES notation for N-but-2-enyl-2,3-dihydroxypropanamide;hydrate?
The canonical SMILES for N-but-2-enyl-2,3-dihydroxypropanamide;hydrate is CC=CCNC(=O)C(O)CO.O.
What is the InChIKey of N-but-2-enyl-2,3-dihydroxypropanamide;hydrate?
The InChIKey is IEDWUVBDQOHLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3.H2O/c1-2-3-4-8-7(11)6(10)5-9;/h2-3,6,9-10H,4-5H2,1H3,(H,8,11);1H2.
What are the key properties of N-but-2-enyl-2,3-dihydroxypropanamide;hydrate?
N-but-2-enyl-2,3-dihydroxypropanamide;hydrate has a molecular weight of 177.20 g/mol, XLogP of -1.79, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-enyl-2,3-dihydroxypropanamide;hydrate is sourced from PubChem (CID 141324143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).