About 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one
5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one (PubChem CID 141324203) has the molecular formula C14H16BrN3O2
and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one |
| PubChem CID | 141324203 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one |
| SMILES | C[C@@H](CO)[C@@H](Nc1nc(Br)c[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-9(8-19)12(10-5-3-2-4-6-10)18-13-14(20)16-7-11(15)17-13/h2-7,9,12,19H,8H2,1H3,(H,16,20)(H,17,18)/t9-,12+/m0/s1 |
| InChIKey | KUEDEDVPOXBGMW-JOYOIKCWSA-N |
| XLogP | 2.31 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one?
The IUPAC name of 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one (CID 141324203) is 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one.
What is the SMILES notation for 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one?
The canonical SMILES for 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one is C[C@@H](CO)[C@@H](Nc1nc(Br)c[nH]c1=O)c1ccccc1.
What is the InChIKey of 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one?
The InChIKey is KUEDEDVPOXBGMW-JOYOIKCWSA-N. The full InChI is InChI=1S/C14H16BrN3O2/c1-9(8-19)12(10-5-3-2-4-6-10)18-13-14(20)16-7-11(15)17-13/h2-7,9,12,19H,8H2,1H3,(H,16,20)(H,17,18)/t9-,12+/m0/s1.
What are the key properties of 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one?
5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one has a molecular weight of 338.21 g/mol, XLogP of 2.31, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[[(1R,2R)-3-hydroxy-2-methyl-1-phenylpropyl]amino]-1H-pyrazin-2-one is sourced from PubChem (CID 141324203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).