About 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one
3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one (PubChem CID 141324215) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one |
| PubChem CID | 141324215 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one |
| SMILES | C[C@@H](CO)[C@@H](Nc1ncc[nH]c1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H19N3O2/c1-12(11-22)16(21-17-18(23)20-10-9-19-17)15-8-4-6-13-5-2-3-7-14(13)15/h2-10,12,16,22H,11H2,1H3,(H,19,21)(H,20,23)/t12-,16+/m0/s1 |
| InChIKey | RCBSBCQWAIBWPE-BLLLJJGKSA-N |
| XLogP | 2.70 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one?
The IUPAC name of 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one (CID 141324215) is 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one.
What is the SMILES notation for 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one?
The canonical SMILES for 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one is C[C@@H](CO)[C@@H](Nc1ncc[nH]c1=O)c1cccc2ccccc12.
What is the InChIKey of 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one?
The InChIKey is RCBSBCQWAIBWPE-BLLLJJGKSA-N. The full InChI is InChI=1S/C18H19N3O2/c1-12(11-22)16(21-17-18(23)20-10-9-19-17)15-8-4-6-13-5-2-3-7-14(13)15/h2-10,12,16,22H,11H2,1H3,(H,19,21)(H,20,23)/t12-,16+/m0/s1.
What are the key properties of 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one?
3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one has a molecular weight of 309.37 g/mol, XLogP of 2.70, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2R)-3-hydroxy-2-methyl-1-naphthalen-1-ylpropyl]amino]-1H-pyrazin-2-one is sourced from PubChem (CID 141324215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).