About [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate
[1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate (PubChem CID 141324466) has the molecular formula C16H12BrNO4S
and a molecular weight of 394.25 g/mol. Its IUPAC name is [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate.
Molecular Properties
| Compound Name | [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate |
| PubChem CID | 141324466 |
| Molecular Formula | C16H12BrNO4S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate |
| SMILES | O=C(OC(O)Cn1sc2ccccc2c1=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H12BrNO4S/c17-11-5-3-4-10(8-11)16(21)22-14(19)9-18-15(20)12-6-1-2-7-13(12)23-18/h1-8,14,19H,9H2 |
| InChIKey | FJOCJEQYYHVBHH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate?
The IUPAC name of [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate (CID 141324466) is [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate.
What is the SMILES notation for [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate?
The canonical SMILES for [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate is O=C(OC(O)Cn1sc2ccccc2c1=O)c1cccc(Br)c1.
What is the InChIKey of [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate?
The InChIKey is FJOCJEQYYHVBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrNO4S/c17-11-5-3-4-10(8-11)16(21)22-14(19)9-18-15(20)12-6-1-2-7-13(12)23-18/h1-8,14,19H,9H2.
What are the key properties of [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate?
[1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate has a molecular weight of 394.25 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-hydroxy-2-(3-oxo-1,2-benzothiazol-2-yl)ethyl] 3-bromobenzoate is sourced from PubChem (CID 141324466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).