C14H22 — CID 141325343
3,5,5,8a-tetramethyl-1,4,4a,6-tetrahydronaphthalene (PubChem CID 141325343) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3,5,5,8a-tetramethyl-1,4,4a,6-tetrahydronaphthalene.
| Compound Name | 3,5,5,8a-tetramethyl-1,4,4a,6-tetrahydronaphthalene |
|---|---|
| PubChem CID | 141325343 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3,5,5,8a-tetramethyl-1,4,4a,6-tetrahydronaphthalene |
| SMILES | CC1=CCC2(C)C=CCC(C)(C)C2C1 |
| InChI | InChI=1S/C14H22/c1-11-6-9-14(4)8-5-7-13(2,3)12(14)10-11/h5-6,8,12H,7,9-10H2,1-4H3 |
| InChIKey | RIEKWSTYAUZFIF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|