About 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide
9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide (PubChem CID 141325455) has the molecular formula C12H12N2O5
and a molecular weight of 264.24 g/mol. Its IUPAC name is 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide.
Molecular Properties
| Compound Name | 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide |
| PubChem CID | 141325455 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide |
| SMILES | CN1C(=O)C2(C(N)=O)OCOC2(O)c2ccccc21 |
| InChI | InChI=1S/C12H12N2O5/c1-14-8-5-3-2-4-7(8)12(17)11(9(13)15,10(14)16)18-6-19-12/h2-5,17H,6H2,1H3,(H2,13,15) |
| InChIKey | WJRZRJGOMICGAQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide?
The IUPAC name of 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide (CID 141325455) is 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide.
What is the SMILES notation for 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide?
The canonical SMILES for 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide is CN1C(=O)C2(C(N)=O)OCOC2(O)c2ccccc21.
What is the InChIKey of 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide?
The InChIKey is WJRZRJGOMICGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5/c1-14-8-5-3-2-4-7(8)12(17)11(9(13)15,10(14)16)18-6-19-12/h2-5,17H,6H2,1H3,(H2,13,15).
What are the key properties of 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide?
9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide has a molecular weight of 264.24 g/mol, XLogP of -0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-hydroxy-5-methyl-4-oxo-[1,3]dioxolo[4,5-c]quinoline-3a-carboxamide is sourced from PubChem (CID 141325455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).