C20H18N2O3 — CID 141325883
3-(3-ethylphenyl)-1-(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)prop-2-en-1-one (PubChem CID 141325883) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-(3-ethylphenyl)-1-(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)prop-2-en-1-one.
| Compound Name | 3-(3-ethylphenyl)-1-(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 141325883 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-(3-ethylphenyl)-1-(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)prop-2-en-1-one |
| SMILES | CCc1cccc(C=CC(=O)c2c(C)[n+]([O-])c3ccccc3[n+]2[O-])c1 |
| InChI | InChI=1S/C20H18N2O3/c1-3-15-7-6-8-16(13-15)11-12-19(23)20-14(2)21(24)17-9-4-5-10-18(17)22(20)25/h4-13H,3H2,1-2H3 |
| InChIKey | IJCRFXARJWNRGX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|