C11H16N4O2 — CID 14132661
(3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 14132661) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 14132661 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](Cc2cnc[nH]2)NC1=O |
| InChI | InChI=1S/C11H16N4O2/c1-6(2)9-11(17)14-8(10(16)15-9)3-7-4-12-5-13-7/h4-6,8-9H,3H2,1-2H3,(H,12,13)(H,14,17)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | CNEIXWVYFRHWEJ-IUCAKERBSA-N |
| XLogP | -0.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |