C14H25N3O2S — CID 141326928
1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-1,4,7-triazonane (PubChem CID 141326928) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-1,4,7-triazonane.
| Compound Name | 1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 141326928 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-1,4,7-triazonane |
| SMILES | CC1=CCC(C)(S(=O)(=O)N2CCNCCNCC2)C=C1 |
| InChI | InChI=1S/C14H25N3O2S/c1-13-3-5-14(2,6-4-13)20(18,19)17-11-9-15-7-8-16-10-12-17/h3-5,15-16H,6-12H2,1-2H3 |
| InChIKey | RVIWLPZQVSOZQU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |