About 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide
3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide (PubChem CID 141327038) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide.
Molecular Properties
| Compound Name | 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide |
| PubChem CID | 141327038 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide |
| SMILES | CC(C)(C)c1c(O)ccc(CCC(N)=O)c1O |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)11-9(15)6-4-8(12(11)17)5-7-10(14)16/h4,6,15,17H,5,7H2,1-3H3,(H2,14,16) |
| InChIKey | JPWGRWBHPNAMFD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide?
The IUPAC name of 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide (CID 141327038) is 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide.
What is the SMILES notation for 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide?
The canonical SMILES for 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide is CC(C)(C)c1c(O)ccc(CCC(N)=O)c1O.
What is the InChIKey of 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide?
The InChIKey is JPWGRWBHPNAMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-13(2,3)11-9(15)6-4-8(12(11)17)5-7-10(14)16/h4,6,15,17H,5,7H2,1-3H3,(H2,14,16).
What are the key properties of 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide?
3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide has a molecular weight of 237.30 g/mol, XLogP of 1.81, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butyl-2,4-dihydroxyphenyl)propanamide is sourced from PubChem (CID 141327038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).