C31H30ClFN4 — CID 141327085
N-[2-[(E)-2-[1-[(2-chlorophenyl)methyl]indol-3-yl]ethenyl]-6-fluoroquinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 141327085) has the molecular formula C31H30ClFN4 and a molecular weight of 513.06 g/mol. Its IUPAC name is N-[2-[(E)-2-[1-[(2-chlorophenyl)methyl]indol-3-yl]ethenyl]-6-fluoroquinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[(E)-2-[1-[(2-chlorophenyl)methyl]indol-3-yl]ethenyl]-6-fluoroquinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 141327085 |
| Molecular Formula | C31H30ClFN4 |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | N-[2-[(E)-2-[1-[(2-chlorophenyl)methyl]indol-3-yl]ethenyl]-6-fluoroquinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cc(/C=C/c2cn(Cc3ccccc3Cl)c3ccccc23)nc2ccc(F)cc12 |
| InChI | InChI=1S/C31H30ClFN4/c1-36(2)17-7-16-34-30-19-25(35-29-15-13-24(33)18-27(29)30)14-12-22-20-37(31-11-6-4-9-26(22)31)21-23-8-3-5-10-28(23)32/h3-6,8-15,18-20H,7,16-17,21H2,1-2H3,(H,34,35)/b14-12+ |
| InChIKey | KREVDIVFETUIHB-WYMLVPIESA-N |
| XLogP | 7.56 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|