About 2-(chloromethyl)-1,3-dimethylpiperidine
2-(chloromethyl)-1,3-dimethylpiperidine (PubChem CID 141327126) has the molecular formula C8H16ClN
and a molecular weight of 161.68 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1,3-dimethylpiperidine |
| PubChem CID | 141327126 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-(chloromethyl)-1,3-dimethylpiperidine |
| SMILES | CC1CCCN(C)C1CCl |
| InChI | InChI=1S/C8H16ClN/c1-7-4-3-5-10(2)8(7)6-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | CJWNPDMCCVYNDD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1,3-dimethylpiperidine?
The IUPAC name of 2-(chloromethyl)-1,3-dimethylpiperidine (CID 141327126) is 2-(chloromethyl)-1,3-dimethylpiperidine.
What is the SMILES notation for 2-(chloromethyl)-1,3-dimethylpiperidine?
The canonical SMILES for 2-(chloromethyl)-1,3-dimethylpiperidine is CC1CCCN(C)C1CCl.
What is the InChIKey of 2-(chloromethyl)-1,3-dimethylpiperidine?
The InChIKey is CJWNPDMCCVYNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClN/c1-7-4-3-5-10(2)8(7)6-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-(chloromethyl)-1,3-dimethylpiperidine?
2-(chloromethyl)-1,3-dimethylpiperidine has a molecular weight of 161.68 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1,3-dimethylpiperidine is sourced from PubChem (CID 141327126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).