C19H18OSi — CID 141327180
trimethyl-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)oxysilane (PubChem CID 141327180) has the molecular formula C19H18OSi and a molecular weight of 299.49 g/mol. Its IUPAC name is trimethyl-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)oxysilane.
| Compound Name | trimethyl-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)oxysilane |
|---|---|
| PubChem CID | 141327180 |
| Molecular Formula | C19H18OSi |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | trimethyl-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)oxysilane |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c([2H])c([2H])c(O[Si](C)(C)C)c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C19H18OSi/c1-21(2,3)20-17-12-10-15-8-7-13-5-4-6-14-9-11-16(17)19(15)18(13)14/h4-12H,1-3H3/i4D,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | JUPQXMBZFLATDZ-MUWNQKDNSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|