C27H28N2O — CID 141327837
5-[(E)-2-(4-butoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole (PubChem CID 141327837) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 5-[(E)-2-(4-butoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole.
| Compound Name | 5-[(E)-2-(4-butoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole |
|---|---|
| PubChem CID | 141327837 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 5-[(E)-2-(4-butoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole |
| SMILES | CCCCOc1ccc(/C(CC)=C(\c2ccccc2)c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C27H28N2O/c1-3-5-17-30-24-14-11-20(12-15-24)25(4-2)27(21-9-7-6-8-10-21)22-13-16-26-23(18-22)19-28-29-26/h6-16,18-19H,3-5,17H2,1-2H3,(H,28,29)/b27-25+ |
| InChIKey | GYGHETITCYBKCJ-IMVLJIQESA-N |
| XLogP | 7.11 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|