C19H18N4 — CID 141327839
5-[(E)-2-[4-[(E)-2-phenylbut-1-enyl]phenyl]ethenyl]-2H-tetrazole (PubChem CID 141327839) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-[(E)-2-[4-[(E)-2-phenylbut-1-enyl]phenyl]ethenyl]-2H-tetrazole.
| Compound Name | 5-[(E)-2-[4-[(E)-2-phenylbut-1-enyl]phenyl]ethenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 141327839 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-[(E)-2-[4-[(E)-2-phenylbut-1-enyl]phenyl]ethenyl]-2H-tetrazole |
| SMILES | CC/C(=C\c1ccc(/C=C/c2nn[nH]n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H18N4/c1-2-17(18-6-4-3-5-7-18)14-16-10-8-15(9-11-16)12-13-19-20-22-23-21-19/h3-14H,2H2,1H3,(H,20,21,22,23)/b13-12+,17-14+ |
| InChIKey | ZRXOXPPGBLTITF-MIFVOYFBSA-N |
| XLogP | 4.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|