C17H28IN3O2 — CID 141327871
tert-butyl 4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]piperidine-1-carboxylate (PubChem CID 141327871) has the molecular formula C17H28IN3O2 and a molecular weight of 433.33 g/mol. Its IUPAC name is tert-butyl 4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141327871 |
| Molecular Formula | C17H28IN3O2 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | tert-butyl 4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)n1cc(CC2CCN(C(=O)OC(C)(C)C)CC2)c(I)n1 |
| InChI | InChI=1S/C17H28IN3O2/c1-12(2)21-11-14(15(18)19-21)10-13-6-8-20(9-7-13)16(22)23-17(3,4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | WBZMZEXNHSYIOL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|