C19H17Cl2F3N2O — CID 141327901
N-[1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]-4-[2-[(4S)-4,5-dihydro-1,3-oxazol-4-yl]ethyl]aniline (PubChem CID 141327901) has the molecular formula C19H17Cl2F3N2O and a molecular weight of 417.26 g/mol. Its IUPAC name is N-[1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]-4-[2-[(4S)-4,5-dihydro-1,3-oxazol-4-yl]ethyl]aniline.
| Compound Name | N-[1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]-4-[2-[(4S)-4,5-dihydro-1,3-oxazol-4-yl]ethyl]aniline |
|---|---|
| PubChem CID | 141327901 |
| Molecular Formula | C19H17Cl2F3N2O |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl]-4-[2-[(4S)-4,5-dihydro-1,3-oxazol-4-yl]ethyl]aniline |
| SMILES | FC(F)(F)C(Nc1ccc(CC[C@H]2COC=N2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2F3N2O/c20-14-7-13(8-15(21)9-14)18(19(22,23)24)26-16-4-1-12(2-5-16)3-6-17-10-27-11-25-17/h1-2,4-5,7-9,11,17-18,26H,3,6,10H2/t17-,18?/m0/s1 |
| InChIKey | UPENBSUBEZQTBA-ZENAZSQFSA-N |
| XLogP | 6.07 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |