C22H17N3O4S — CID 141328054
ethyl 1-[3-(1-oxidopyridin-1-ium-3-yl)sulfanylphenyl]-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 141328054) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is ethyl 1-[3-(1-oxidopyridin-1-ium-3-yl)sulfanylphenyl]-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-[3-(1-oxidopyridin-1-ium-3-yl)sulfanylphenyl]-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 141328054 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | ethyl 1-[3-(1-oxidopyridin-1-ium-3-yl)sulfanylphenyl]-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cccc(Sc3ccc[n+]([O-])c3)c2)c2ncccc2c1=O |
| InChI | InChI=1S/C22H17N3O4S/c1-2-29-22(27)19-14-25(21-18(20(19)26)9-4-10-23-21)15-6-3-7-16(12-15)30-17-8-5-11-24(28)13-17/h3-14H,2H2,1H3 |
| InChIKey | PAMBHVIQMILDFT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|