About 3,3,3-trifluoropropyl trifluoromethanesulfonate
3,3,3-trifluoropropyl trifluoromethanesulfonate (PubChem CID 14132849) has the molecular formula C4H4F6O3S
and a molecular weight of 246.13 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 3,3,3-trifluoropropyl trifluoromethanesulfonate |
| PubChem CID | 14132849 |
| Molecular Formula | C4H4F6O3S |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 3,3,3-trifluoropropyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O3S/c5-3(6,7)1-2-13-14(11,12)4(8,9)10/h1-2H2 |
| InChIKey | CFROLHNCACAAOW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 3,3,3-trifluoropropyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoropropyl trifluoromethanesulfonate?
The IUPAC name of 3,3,3-trifluoropropyl trifluoromethanesulfonate (CID 14132849) is 3,3,3-trifluoropropyl trifluoromethanesulfonate.
What is the SMILES notation for 3,3,3-trifluoropropyl trifluoromethanesulfonate?
The canonical SMILES for 3,3,3-trifluoropropyl trifluoromethanesulfonate is O=S(=O)(OCCC(F)(F)F)C(F)(F)F.
What is the InChIKey of 3,3,3-trifluoropropyl trifluoromethanesulfonate?
The InChIKey is CFROLHNCACAAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F6O3S/c5-3(6,7)1-2-13-14(11,12)4(8,9)10/h1-2H2.
What are the key properties of 3,3,3-trifluoropropyl trifluoromethanesulfonate?
3,3,3-trifluoropropyl trifluoromethanesulfonate has a molecular weight of 246.13 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoropropyl trifluoromethanesulfonate is sourced from PubChem (CID 14132849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).