C16H14N2O — CID 141328667
8-naphthalen-1-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine (PubChem CID 141328667) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 8-naphthalen-1-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine.
| Compound Name | 8-naphthalen-1-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 141328667 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 8-naphthalen-1-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
| SMILES | c1ccc2c(C3OCCn4cncc43)cccc2c1 |
| InChI | InChI=1S/C16H14N2O/c1-2-6-13-12(4-1)5-3-7-14(13)16-15-10-17-11-18(15)8-9-19-16/h1-7,10-11,16H,8-9H2 |
| InChIKey | NXUITOLYCOGIHT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |