C9H10F3NaO3S — CID 141329153
sodium 1-(3,3,3-trifluoropropyl)cyclohexa-2,4-diene-1-sulfonate (PubChem CID 141329153) has the molecular formula C9H10F3NaO3S and a molecular weight of 278.23 g/mol. Its IUPAC name is sodium 1-(3,3,3-trifluoropropyl)cyclohexa-2,4-diene-1-sulfonate.
| Compound Name | sodium 1-(3,3,3-trifluoropropyl)cyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 141329153 |
| Molecular Formula | C9H10F3NaO3S |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | sodium 1-(3,3,3-trifluoropropyl)cyclohexa-2,4-diene-1-sulfonate |
| SMILES | O=S(=O)([O-])C1(CCC(F)(F)F)C=CC=CC1.[Na+] |
| InChI | InChI=1S/C9H11F3O3S.Na/c10-9(11,12)7-6-8(16(13,14)15)4-2-1-3-5-8;/h1-4H,5-7H2,(H,13,14,15);/q;+1/p-1 |
| InChIKey | PEFWZFFFNNFBNO-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|