C18H15N3O3 — CID 141329300
(3-phenoxyazetidin-1-yl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanone (PubChem CID 141329300) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is (3-phenoxyazetidin-1-yl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanone.
| Compound Name | (3-phenoxyazetidin-1-yl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanone |
|---|---|
| PubChem CID | 141329300 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (3-phenoxyazetidin-1-yl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanone |
| SMILES | O=C(c1nnc(-c2ccccc2)o1)N1CC(Oc2ccccc2)C1 |
| InChI | InChI=1S/C18H15N3O3/c22-18(17-20-19-16(24-17)13-7-3-1-4-8-13)21-11-15(12-21)23-14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | GRZIUDHPIZMGKI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |